You have no items in your shopping cart.
Cart summary
4-O-Caffeoylshikimic acid
Catalog Number: orb1984242
| Catalog Number | orb1984242 |
|---|---|
| Category | Small Molecules |
| Description | 4-O-Caffeoylshikimic acid is a natural product from Illicium verum. |
| CAS Number | 180842-65-3 |
| Purity | 98.00% |
| MW | 336.29 |
| SMILES | O(C(/C=C/C1=CC(O)=C(O)C=C1)=O)[C@H]2[C@H](O)CC(C(O)=O)=C[C@H]2O |
| Formula | C16H16O8 |
| Biological Activity | 4-O-Caffeoylshikimic acid is a natural product from Illicium verum. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
