You have no items in your shopping cart.
Cart summary
4'-Methoxyagarotetrol
Catalog Number: orb1684846
| Catalog Number | orb1684846 |
|---|---|
| Category | Small Molecules |
| Description | 4'-Methoxyagarotetrol |
| CAS Number | 123278-01-3 |
| Purity | 98% |
| MW | 348.351 |
| SMILES | COc1ccc(CCc2cc(=O)c3[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)c3o2)cc1 |
| Formula | C18H20O7 |
| Biological Activity | 4'-Methoxyagarotetrol is a natural product |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
