You have no items in your shopping cart.
Cart summary
3-pyridine toxoflavin
Catalog Number: orb1685602
| Catalog Number | orb1685602 |
|---|---|
| Category | Small Molecules |
| Description | 3-pyridine toxoflavin |
| CAS Number | 32502-20-8 |
| Purity | 99.83% |
| MW | 270.25 |
| SMILES | O=C1N=C2C(=NC(=NN2C)C3=CC=NC=C3)C(=O)N1C |
| Formula | C12H10N6O2 |
| Biological Activity | 3-pyridine toxoflavin is a potent KDM4C inhibitor, IC50=19nM. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
