You have no items in your shopping cart.
Cart summary
3-Chloro-1,2-Propanediol-d5
Catalog Number: orb2299632
| Catalog Number | orb2299632 |
|---|---|
| Category | Small Molecules |
| Description | 3-Chloro-1,2-Propanediol-d5 is a deuterated compound of 3-Chloro-1,2-Propanediol. 3-Chloro-1,2-Propanediol has a CAS number of 96-24-2. |
| CAS Number | 342611-01-2 |
| Purity | 98.00% |
| MW | 115.57 |
| SMILES | [2H]C(O)(C(O)(C(Cl)([2H])[2H])[2H])[2H] |
| Formula | C3D5H2ClO2 |
| Biological Activity | 3-Chloro-1,2-Propanediol-d5 is a deuterated compound of 3-Chloro-1,2-Propanediol. 3-Chloro-1,2-Propanediol has a CAS number of 96-24-2. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
