You have no items in your shopping cart.
Cart summary
2-Hydroxy-1-Methoxyaporphine
Catalog Number: orb1684890
| Catalog Number | orb1684890 |
|---|---|
| Category | Small Molecules |
| Description | 2-Hydroxy-1-Methoxyaporphine |
| CAS Number | 33770-27-3 |
| Purity | 98% |
| MW | 281.35 |
| SMILES | OC=1C=C2C3=C(C1OC)C4=CC=CC=C4CC3N(C)CC2 |
| Formula | C18H19NO2 |
| Biological Activity | 2-Hydroxy-1-Methoxyaporphine can inhibit CYP2D6 activity, it also increase the glucose consumption significantly as rosiglitazone. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
