You have no items in your shopping cart.
Cart summary
1-Naphthaleneacetic acid potassium salt
Catalog Number: orb1301674
| Catalog Number | orb1301674 |
|---|---|
| Category | Small Molecules |
| Description | 1-Naphthaleneacetic acid potassium salt |
| CAS Number | 15165-79-4 |
| Purity | 97.68% |
| MW | 224.3 |
| SMILES | [K+].[O-]C(=O)Cc1cccc2ccccc12 |
| Formula | C12H9KO2 |
| Biological Activity | 1-Naphthaleneacetic acid potassium salt (1-NAA Potassium Salt) is used as a plant Growth Regulator that affects conidial germination, sporulation, mycelial growth, cell surface morphology, and the viability of certain fungal plant pathogens. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
