You have no items in your shopping cart.
Cart summary
1-BCP
Catalog Number: orb1299689
| Catalog Number | orb1299689 |
|---|---|
| Category | Small Molecules |
| Description | 1-BCP |
| CAS Number | 34023-62-6 |
| Purity | 98% |
| MW | 233.26 |
| SMILES | O=C(N1CCCCC1)c1ccc2OCOc2c1 |
| Formula | C13H15NO3 |
| Biological Activity | 1-BCP (Piperonylic acid piperidide) is a centrally active drug that modulates AMPA receptor gated currents. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
